C15H15ClN2O5S2 — CID 8942761
[(2R)-1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] 2-chloro-5-sulfamoylbenzoate (PubChem CID 8942761) has the molecular formula C15H15ClN2O5S2 and a molecular weight of 402.88 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] 2-chloro-5-sulfamoylbenzoate.
| Compound Name | [(2R)-1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] 2-chloro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 8942761 |
| Molecular Formula | C15H15ClN2O5S2 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | [(2R)-1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] 2-chloro-5-sulfamoylbenzoate |
| SMILES | C[C@@H](OC(=O)c1cc(S(N)(=O)=O)ccc1Cl)C(=O)NCc1cccs1 |
| InChI | InChI=1S/C15H15ClN2O5S2/c1-9(14(19)18-8-10-3-2-6-24-10)23-15(20)12-7-11(25(17,21)22)4-5-13(12)16/h2-7,9H,8H2,1H3,(H,18,19)(H2,17,21,22)/t9-/m1/s1 |
| InChIKey | FTNQWNULNCPSTH-SECBINFHSA-N |
| XLogP | 1.91 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |