C15H15ClN2O5S2 — CID 31729782
[2-[methyl(thiophen-2-ylmethyl)amino]-2-oxoethyl] 2-chloro-5-sulfamoylbenzoate (PubChem CID 31729782) has the molecular formula C15H15ClN2O5S2 and a molecular weight of 402.88 g/mol. Its IUPAC name is [2-[methyl(thiophen-2-ylmethyl)amino]-2-oxoethyl] 2-chloro-5-sulfamoylbenzoate.
| Compound Name | [2-[methyl(thiophen-2-ylmethyl)amino]-2-oxoethyl] 2-chloro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 31729782 |
| Molecular Formula | C15H15ClN2O5S2 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | [2-[methyl(thiophen-2-ylmethyl)amino]-2-oxoethyl] 2-chloro-5-sulfamoylbenzoate |
| SMILES | CN(Cc1cccs1)C(=O)COC(=O)c1cc(S(N)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C15H15ClN2O5S2/c1-18(8-10-3-2-6-24-10)14(19)9-23-15(20)12-7-11(25(17,21)22)4-5-13(12)16/h2-7H,8-9H2,1H3,(H2,17,21,22) |
| InChIKey | ISVMLZHEVRKDDK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |