C22H21ClN2O5S2 — CID 2693479
[2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 5-[benzyl(methyl)sulfamoyl]-2-chlorobenzoate (PubChem CID 2693479) has the molecular formula C22H21ClN2O5S2 and a molecular weight of 493.01 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 5-[benzyl(methyl)sulfamoyl]-2-chlorobenzoate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 5-[benzyl(methyl)sulfamoyl]-2-chlorobenzoate |
|---|---|
| PubChem CID | 2693479 |
| Molecular Formula | C22H21ClN2O5S2 |
| Molecular Weight | 493.01 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 5-[benzyl(methyl)sulfamoyl]-2-chlorobenzoate |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)c1ccc(Cl)c(C(=O)OCC(=O)NCc2cccs2)c1 |
| InChI | InChI=1S/C22H21ClN2O5S2/c1-25(14-16-6-3-2-4-7-16)32(28,29)18-9-10-20(23)19(12-18)22(27)30-15-21(26)24-13-17-8-5-11-31-17/h2-12H,13-15H2,1H3,(H,24,26) |
| InChIKey | SQILYBBATHIQSI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.01 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |