C21H27N3O5S2 — CID 43027310
[2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 5-(dimethylsulfamoyl)-2-piperidin-1-ylbenzoate (PubChem CID 43027310) has the molecular formula C21H27N3O5S2 and a molecular weight of 465.60 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 5-(dimethylsulfamoyl)-2-piperidin-1-ylbenzoate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 5-(dimethylsulfamoyl)-2-piperidin-1-ylbenzoate |
|---|---|
| PubChem CID | 43027310 |
| Molecular Formula | C21H27N3O5S2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 5-(dimethylsulfamoyl)-2-piperidin-1-ylbenzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(N2CCCCC2)c(C(=O)OCC(=O)NCc2cccs2)c1 |
| InChI | InChI=1S/C21H27N3O5S2/c1-23(2)31(27,28)17-8-9-19(24-10-4-3-5-11-24)18(13-17)21(26)29-15-20(25)22-14-16-7-6-12-30-16/h6-9,12-13H,3-5,10-11,14-15H2,1-2H3,(H,22,25) |
| InChIKey | KPUSFPNQLRWNMH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |