C23H25N3O6S — CID 43027316
(1,3-dioxoisoindol-2-yl)methyl 5-(dimethylsulfamoyl)-2-piperidin-1-ylbenzoate (PubChem CID 43027316) has the molecular formula C23H25N3O6S and a molecular weight of 471.54 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 5-(dimethylsulfamoyl)-2-piperidin-1-ylbenzoate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 5-(dimethylsulfamoyl)-2-piperidin-1-ylbenzoate |
|---|---|
| PubChem CID | 43027316 |
| Molecular Formula | C23H25N3O6S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 5-(dimethylsulfamoyl)-2-piperidin-1-ylbenzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(N2CCCCC2)c(C(=O)OCN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C23H25N3O6S/c1-24(2)33(30,31)16-10-11-20(25-12-6-3-7-13-25)19(14-16)23(29)32-15-26-21(27)17-8-4-5-9-18(17)22(26)28/h4-5,8-11,14H,3,6-7,12-13,15H2,1-2H3 |
| InChIKey | LLCOBBNUXYQKLV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 104.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|