C22H26N2O7S — CID 42983355
2-benzoyloxyethyl 5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoate (PubChem CID 42983355) has the molecular formula C22H26N2O7S and a molecular weight of 462.52 g/mol. Its IUPAC name is 2-benzoyloxyethyl 5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoate.
| Compound Name | 2-benzoyloxyethyl 5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 42983355 |
| Molecular Formula | C22H26N2O7S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 2-benzoyloxyethyl 5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(N2CCOCC2)c(C(=O)OCCOC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C22H26N2O7S/c1-23(2)32(27,28)18-8-9-20(24-10-12-29-13-11-24)19(16-18)22(26)31-15-14-30-21(25)17-6-4-3-5-7-17/h3-9,16H,10-15H2,1-2H3 |
| InChIKey | WKJACBYEVOZCNQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|