C22H25ClN2O6S — CID 22109208
[1-(3-chlorophenyl)-1-oxopropan-2-yl] 5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoate (PubChem CID 22109208) has the molecular formula C22H25ClN2O6S and a molecular weight of 480.97 g/mol. Its IUPAC name is [1-(3-chlorophenyl)-1-oxopropan-2-yl] 5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoate.
| Compound Name | [1-(3-chlorophenyl)-1-oxopropan-2-yl] 5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 22109208 |
| Molecular Formula | C22H25ClN2O6S |
| Molecular Weight | 480.97 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | [1-(3-chlorophenyl)-1-oxopropan-2-yl] 5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoate |
| SMILES | CC(OC(=O)c1cc(S(=O)(=O)N(C)C)ccc1N1CCOCC1)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H25ClN2O6S/c1-15(21(26)16-5-4-6-17(23)13-16)31-22(27)19-14-18(32(28,29)24(2)3)7-8-20(19)25-9-11-30-12-10-25/h4-8,13-15H,9-12H2,1-3H3 |
| InChIKey | VICVYAUGSMUKPV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.97 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |