C22H26N2O7S — CID 42985820
[2-(3-methoxyphenyl)-2-oxoethyl] 5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoate (PubChem CID 42985820) has the molecular formula C22H26N2O7S and a molecular weight of 462.52 g/mol. Its IUPAC name is [2-(3-methoxyphenyl)-2-oxoethyl] 5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoate.
| Compound Name | [2-(3-methoxyphenyl)-2-oxoethyl] 5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 42985820 |
| Molecular Formula | C22H26N2O7S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | [2-(3-methoxyphenyl)-2-oxoethyl] 5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoate |
| SMILES | COc1cccc(C(=O)COC(=O)c2cc(S(=O)(=O)N(C)C)ccc2N2CCOCC2)c1 |
| InChI | InChI=1S/C22H26N2O7S/c1-23(2)32(27,28)18-7-8-20(24-9-11-30-12-10-24)19(14-18)22(26)31-15-21(25)16-5-4-6-17(13-16)29-3/h4-8,13-14H,9-12,15H2,1-3H3 |
| InChIKey | OHAKHIKHBGZHJD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |