C19H29N3O6S — CID 7883894
[2-[[(2S)-butan-2-yl]amino]-2-oxoethyl] 5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoate (PubChem CID 7883894) has the molecular formula C19H29N3O6S and a molecular weight of 427.52 g/mol. Its IUPAC name is [2-[[(2S)-butan-2-yl]amino]-2-oxoethyl] 5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoate.
| Compound Name | [2-[[(2S)-butan-2-yl]amino]-2-oxoethyl] 5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 7883894 |
| Molecular Formula | C19H29N3O6S |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | [2-[[(2S)-butan-2-yl]amino]-2-oxoethyl] 5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoate |
| SMILES | CC[C@H](C)NC(=O)COC(=O)c1cc(S(=O)(=O)N(C)C)ccc1N1CCOCC1 |
| InChI | InChI=1S/C19H29N3O6S/c1-5-14(2)20-18(23)13-28-19(24)16-12-15(29(25,26)21(3)4)6-7-17(16)22-8-10-27-11-9-22/h6-7,12,14H,5,8-11,13H2,1-4H3,(H,20,23)/t14-/m0/s1 |
| InChIKey | DLQSEYGVLOLQEI-AWEZNQCLSA-N |
| XLogP | 0.85 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |