C17H24N2O7S — CID 22109188
(1-methoxy-1-oxopropan-2-yl) 5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoate (PubChem CID 22109188) has the molecular formula C17H24N2O7S and a molecular weight of 400.45 g/mol. Its IUPAC name is (1-methoxy-1-oxopropan-2-yl) 5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoate.
| Compound Name | (1-methoxy-1-oxopropan-2-yl) 5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 22109188 |
| Molecular Formula | C17H24N2O7S |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | (1-methoxy-1-oxopropan-2-yl) 5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoate |
| SMILES | COC(=O)C(C)OC(=O)c1cc(S(=O)(=O)N(C)C)ccc1N1CCOCC1 |
| InChI | InChI=1S/C17H24N2O7S/c1-12(16(20)24-4)26-17(21)14-11-13(27(22,23)18(2)3)5-6-15(14)19-7-9-25-10-8-19/h5-6,11-12H,7-10H2,1-4H3 |
| InChIKey | CSJAURDKCYTILQ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |