C22H28N2O6S — CID 55568899
3-phenoxypropyl 5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoate (PubChem CID 55568899) has the molecular formula C22H28N2O6S and a molecular weight of 448.54 g/mol. Its IUPAC name is 3-phenoxypropyl 5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoate.
| Compound Name | 3-phenoxypropyl 5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 55568899 |
| Molecular Formula | C22H28N2O6S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 3-phenoxypropyl 5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(N2CCOCC2)c(C(=O)OCCCOc2ccccc2)c1 |
| InChI | InChI=1S/C22H28N2O6S/c1-23(2)31(26,27)19-9-10-21(24-11-15-28-16-12-24)20(17-19)22(25)30-14-6-13-29-18-7-4-3-5-8-18/h3-5,7-10,17H,6,11-16H2,1-2H3 |
| InChIKey | QJXYLLRGKXMTSQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|