C21H32N2O6S — CID 55358452
oxan-2-ylmethyl 5-(diethylsulfamoyl)-2-morpholin-4-ylbenzoate (PubChem CID 55358452) has the molecular formula C21H32N2O6S and a molecular weight of 440.56 g/mol. Its IUPAC name is oxan-2-ylmethyl 5-(diethylsulfamoyl)-2-morpholin-4-ylbenzoate.
| Compound Name | oxan-2-ylmethyl 5-(diethylsulfamoyl)-2-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 55358452 |
| Molecular Formula | C21H32N2O6S |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | oxan-2-ylmethyl 5-(diethylsulfamoyl)-2-morpholin-4-ylbenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCOCC2)c(C(=O)OCC2CCCCO2)c1 |
| InChI | InChI=1S/C21H32N2O6S/c1-3-23(4-2)30(25,26)18-8-9-20(22-10-13-27-14-11-22)19(15-18)21(24)29-16-17-7-5-6-12-28-17/h8-9,15,17H,3-7,10-14,16H2,1-2H3 |
| InChIKey | LNVRRRFCKDFVSZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |