C22H37N3O4S — CID 55591057
5-(diethylsulfamoyl)-N-methyl-N-(4-methylpentan-2-yl)-2-morpholin-4-ylbenzamide (PubChem CID 55591057) has the molecular formula C22H37N3O4S and a molecular weight of 439.62 g/mol. Its IUPAC name is 5-(diethylsulfamoyl)-N-methyl-N-(4-methylpentan-2-yl)-2-morpholin-4-ylbenzamide.
| Compound Name | 5-(diethylsulfamoyl)-N-methyl-N-(4-methylpentan-2-yl)-2-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 55591057 |
| Molecular Formula | C22H37N3O4S |
| Molecular Weight | 439.62 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 5-(diethylsulfamoyl)-N-methyl-N-(4-methylpentan-2-yl)-2-morpholin-4-ylbenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCOCC2)c(C(=O)N(C)C(C)CC(C)C)c1 |
| InChI | InChI=1S/C22H37N3O4S/c1-7-25(8-2)30(27,28)19-9-10-21(24-11-13-29-14-12-24)20(16-19)22(26)23(6)18(5)15-17(3)4/h9-10,16-18H,7-8,11-15H2,1-6H3 |
| InChIKey | FCUUFEDWXRBBCU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.62 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |