C20H32N4O4S — CID 9277220
5-(diethylsulfamoyl)-N-[2-oxo-2-(propan-2-ylamino)ethyl]-2-pyrrolidin-1-ylbenzamide (PubChem CID 9277220) has the molecular formula C20H32N4O4S and a molecular weight of 424.57 g/mol. Its IUPAC name is 5-(diethylsulfamoyl)-N-[2-oxo-2-(propan-2-ylamino)ethyl]-2-pyrrolidin-1-ylbenzamide.
| Compound Name | 5-(diethylsulfamoyl)-N-[2-oxo-2-(propan-2-ylamino)ethyl]-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 9277220 |
| Molecular Formula | C20H32N4O4S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 5-(diethylsulfamoyl)-N-[2-oxo-2-(propan-2-ylamino)ethyl]-2-pyrrolidin-1-ylbenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCCC2)c(C(=O)NCC(=O)NC(C)C)c1 |
| InChI | InChI=1S/C20H32N4O4S/c1-5-24(6-2)29(27,28)16-9-10-18(23-11-7-8-12-23)17(13-16)20(26)21-14-19(25)22-15(3)4/h9-10,13,15H,5-8,11-12,14H2,1-4H3,(H,21,26)(H,22,25) |
| InChIKey | RRHDCTVOCYZADI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |