C22H36N4O4S — CID 55993412
N-[3-(butan-2-ylamino)-3-oxopropyl]-5-(diethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide (PubChem CID 55993412) has the molecular formula C22H36N4O4S and a molecular weight of 452.62 g/mol. Its IUPAC name is N-[3-(butan-2-ylamino)-3-oxopropyl]-5-(diethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[3-(butan-2-ylamino)-3-oxopropyl]-5-(diethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 55993412 |
| Molecular Formula | C22H36N4O4S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | N-[3-(butan-2-ylamino)-3-oxopropyl]-5-(diethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide |
| SMILES | CCC(C)NC(=O)CCNC(=O)c1cc(S(=O)(=O)N(CC)CC)ccc1N1CCCC1 |
| InChI | InChI=1S/C22H36N4O4S/c1-5-17(4)24-21(27)12-13-23-22(28)19-16-18(31(29,30)26(6-2)7-3)10-11-20(19)25-14-8-9-15-25/h10-11,16-17H,5-9,12-15H2,1-4H3,(H,23,28)(H,24,27) |
| InChIKey | WMFFAOHVHPNOTR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |