C23H34N4O4S — CID 55332364
5-(diethylsulfamoyl)-N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-pyrrolidin-1-ylbenzamide (PubChem CID 55332364) has the molecular formula C23H34N4O4S and a molecular weight of 462.62 g/mol. Its IUPAC name is 5-(diethylsulfamoyl)-N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-pyrrolidin-1-ylbenzamide.
| Compound Name | 5-(diethylsulfamoyl)-N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 55332364 |
| Molecular Formula | C23H34N4O4S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 5-(diethylsulfamoyl)-N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-pyrrolidin-1-ylbenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCCC2)c(C(=O)NCC(c2ccco2)N(C)C)c1 |
| InChI | InChI=1S/C23H34N4O4S/c1-5-27(6-2)32(29,30)18-11-12-20(26-13-7-8-14-26)19(16-18)23(28)24-17-21(25(3)4)22-10-9-15-31-22/h9-12,15-16,21H,5-8,13-14,17H2,1-4H3,(H,24,28) |
| InChIKey | QMZXRZWZEFAQRZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |