C23H28N4O3S2 — CID 112765302
N-(1,3-benzothiazol-2-ylmethyl)-5-(diethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide (PubChem CID 112765302) has the molecular formula C23H28N4O3S2 and a molecular weight of 472.64 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-5-(diethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-5-(diethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 112765302 |
| Molecular Formula | C23H28N4O3S2 |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-5-(diethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCCC2)c(C(=O)NCc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C23H28N4O3S2/c1-3-27(4-2)32(29,30)17-11-12-20(26-13-7-8-14-26)18(15-17)23(28)24-16-22-25-19-9-5-6-10-21(19)31-22/h5-6,9-12,15H,3-4,7-8,13-14,16H2,1-2H3,(H,24,28) |
| InChIKey | MTIXSZBOUDKYOQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |