C17H29ClN4O4S — CID 119383889
N-(2-aminoethyl)-5-(diethylsulfamoyl)-2-morpholin-4-ylbenzamide;hydrochloride (PubChem CID 119383889) has the molecular formula C17H29ClN4O4S and a molecular weight of 420.96 g/mol. Its IUPAC name is N-(2-aminoethyl)-5-(diethylsulfamoyl)-2-morpholin-4-ylbenzamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-5-(diethylsulfamoyl)-2-morpholin-4-ylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119383889 |
| Molecular Formula | C17H29ClN4O4S |
| Molecular Weight | 420.96 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | N-(2-aminoethyl)-5-(diethylsulfamoyl)-2-morpholin-4-ylbenzamide;hydrochloride |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCOCC2)c(C(=O)NCCN)c1.Cl |
| InChI | InChI=1S/C17H28N4O4S.ClH/c1-3-21(4-2)26(23,24)14-5-6-16(20-9-11-25-12-10-20)15(13-14)17(22)19-8-7-18;/h5-6,13H,3-4,7-12,18H2,1-2H3,(H,19,22);1H |
| InChIKey | FPVWOWAKHAOTGK-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.96 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |