C18H28N4O6S — CID 56557592
ethyl N-[2-[[5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoyl]amino]ethyl]carbamate (PubChem CID 56557592) has the molecular formula C18H28N4O6S and a molecular weight of 428.51 g/mol. Its IUPAC name is ethyl N-[2-[[5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoyl]amino]ethyl]carbamate.
| Compound Name | ethyl N-[2-[[5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 56557592 |
| Molecular Formula | C18H28N4O6S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | ethyl N-[2-[[5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoyl]amino]ethyl]carbamate |
| SMILES | CCOC(=O)NCCNC(=O)c1cc(S(=O)(=O)N(C)C)ccc1N1CCOCC1 |
| InChI | InChI=1S/C18H28N4O6S/c1-4-28-18(24)20-8-7-19-17(23)15-13-14(29(25,26)21(2)3)5-6-16(15)22-9-11-27-12-10-22/h5-6,13H,4,7-12H2,1-3H3,(H,19,23)(H,20,24) |
| InChIKey | YWKKAQSYXKQMMZ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|