C21H27N3O6S — CID 55638218
5-(dimethylsulfamoyl)-N-[(4-hydroxy-3-methoxyphenyl)methyl]-2-morpholin-4-ylbenzamide (PubChem CID 55638218) has the molecular formula C21H27N3O6S and a molecular weight of 449.53 g/mol. Its IUPAC name is 5-(dimethylsulfamoyl)-N-[(4-hydroxy-3-methoxyphenyl)methyl]-2-morpholin-4-ylbenzamide.
| Compound Name | 5-(dimethylsulfamoyl)-N-[(4-hydroxy-3-methoxyphenyl)methyl]-2-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 55638218 |
| Molecular Formula | C21H27N3O6S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 5-(dimethylsulfamoyl)-N-[(4-hydroxy-3-methoxyphenyl)methyl]-2-morpholin-4-ylbenzamide |
| SMILES | COc1cc(CNC(=O)c2cc(S(=O)(=O)N(C)C)ccc2N2CCOCC2)ccc1O |
| InChI | InChI=1S/C21H27N3O6S/c1-23(2)31(27,28)16-5-6-18(24-8-10-30-11-9-24)17(13-16)21(26)22-14-15-4-7-19(25)20(12-15)29-3/h4-7,12-13,25H,8-11,14H2,1-3H3,(H,22,26) |
| InChIKey | HUJHXVVHSOLBBE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |