C23H31N5O5S — CID 32587961
5-(dimethylsulfamoyl)-2-morpholin-4-yl-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]benzamide (PubChem CID 32587961) has the molecular formula C23H31N5O5S and a molecular weight of 489.60 g/mol. Its IUPAC name is 5-(dimethylsulfamoyl)-2-morpholin-4-yl-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]benzamide.
| Compound Name | 5-(dimethylsulfamoyl)-2-morpholin-4-yl-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]benzamide |
|---|---|
| PubChem CID | 32587961 |
| Molecular Formula | C23H31N5O5S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 5-(dimethylsulfamoyl)-2-morpholin-4-yl-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]benzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(N2CCOCC2)c(C(=O)NCc2ccnc(N3CCOCC3)c2)c1 |
| InChI | InChI=1S/C23H31N5O5S/c1-26(2)34(30,31)19-3-4-21(27-7-11-32-12-8-27)20(16-19)23(29)25-17-18-5-6-24-22(15-18)28-9-13-33-14-10-28/h3-6,15-16H,7-14,17H2,1-2H3,(H,25,29) |
| InChIKey | LSXCNGATPROXGS-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |