C17H22Cl2N4O2 — CID 119946489
2-amino-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]benzamide;dihydrochloride (PubChem CID 119946489) has the molecular formula C17H22Cl2N4O2 and a molecular weight of 385.30 g/mol. Its IUPAC name is 2-amino-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]benzamide;dihydrochloride.
| Compound Name | 2-amino-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119946489 |
| Molecular Formula | C17H22Cl2N4O2 |
| Molecular Weight | 385.30 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 2-amino-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]benzamide;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccccc1C(=O)NCc1ccnc(N2CCOCC2)c1 |
| InChI | InChI=1S/C17H20N4O2.2ClH/c18-15-4-2-1-3-14(15)17(22)20-12-13-5-6-19-16(11-13)21-7-9-23-10-8-21;;/h1-6,11H,7-10,12,18H2,(H,20,22);2*1H |
| InChIKey | ZWWREBDCKGUMEL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|