C18H24Cl2N4O — CID 119946399
2-amino-N-[(2-piperidin-1-yl-4-pyridinyl)methyl]benzamide;dihydrochloride (PubChem CID 119946399) has the molecular formula C18H24Cl2N4O and a molecular weight of 383.32 g/mol. Its IUPAC name is 2-amino-N-[(2-piperidin-1-yl-4-pyridinyl)methyl]benzamide;dihydrochloride.
| Compound Name | 2-amino-N-[(2-piperidin-1-yl-4-pyridinyl)methyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119946399 |
| Molecular Formula | C18H24Cl2N4O |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 2-amino-N-[(2-piperidin-1-yl-4-pyridinyl)methyl]benzamide;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccccc1C(=O)NCc1ccnc(N2CCCCC2)c1 |
| InChI | InChI=1S/C18H22N4O.2ClH/c19-16-7-3-2-6-15(16)18(23)21-13-14-8-9-20-17(12-14)22-10-4-1-5-11-22;;/h2-3,6-9,12H,1,4-5,10-11,13,19H2,(H,21,23);2*1H |
| InChIKey | QEXXXZLHLUUHOX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|