C23H23N3O — CID 55522332
4-phenyl-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]benzamide (PubChem CID 55522332) has the molecular formula C23H23N3O and a molecular weight of 357.46 g/mol. Its IUPAC name is 4-phenyl-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]benzamide.
| Compound Name | 4-phenyl-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]benzamide |
|---|---|
| PubChem CID | 55522332 |
| Molecular Formula | C23H23N3O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 4-phenyl-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]benzamide |
| SMILES | O=C(NCc1ccnc(N2CCCC2)c1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23N3O/c27-23(21-10-8-20(9-11-21)19-6-2-1-3-7-19)25-17-18-12-13-24-22(16-18)26-14-4-5-15-26/h1-3,6-13,16H,4-5,14-15,17H2,(H,25,27) |
| InChIKey | MESUSBDHDNBLKN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |