C20H28Cl2N4O — CID 120595081
2-amino-2-phenyl-N-[(2-piperidin-1-yl-4-pyridinyl)methyl]propanamide;dihydrochloride (PubChem CID 120595081) has the molecular formula C20H28Cl2N4O and a molecular weight of 411.38 g/mol. Its IUPAC name is 2-amino-2-phenyl-N-[(2-piperidin-1-yl-4-pyridinyl)methyl]propanamide;dihydrochloride.
| Compound Name | 2-amino-2-phenyl-N-[(2-piperidin-1-yl-4-pyridinyl)methyl]propanamide;dihydrochloride |
|---|---|
| PubChem CID | 120595081 |
| Molecular Formula | C20H28Cl2N4O |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 2-amino-2-phenyl-N-[(2-piperidin-1-yl-4-pyridinyl)methyl]propanamide;dihydrochloride |
| SMILES | CC(N)(C(=O)NCc1ccnc(N2CCCCC2)c1)c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C20H26N4O.2ClH/c1-20(21,17-8-4-2-5-9-17)19(25)23-15-16-10-11-22-18(14-16)24-12-6-3-7-13-24;;/h2,4-5,8-11,14H,3,6-7,12-13,15,21H2,1H3,(H,23,25);2*1H |
| InChIKey | QNQFCRPFHBADDU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |