C21H26N4O4 — CID 32584361
2-methoxy-N-[3-[(2-morpholin-4-yl-4-pyridinyl)methylamino]-3-oxopropyl]benzamide (PubChem CID 32584361) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is 2-methoxy-N-[3-[(2-morpholin-4-yl-4-pyridinyl)methylamino]-3-oxopropyl]benzamide.
| Compound Name | 2-methoxy-N-[3-[(2-morpholin-4-yl-4-pyridinyl)methylamino]-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 32584361 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 2-methoxy-N-[3-[(2-morpholin-4-yl-4-pyridinyl)methylamino]-3-oxopropyl]benzamide |
| SMILES | COc1ccccc1C(=O)NCCC(=O)NCc1ccnc(N2CCOCC2)c1 |
| InChI | InChI=1S/C21H26N4O4/c1-28-18-5-3-2-4-17(18)21(27)23-9-7-20(26)24-15-16-6-8-22-19(14-16)25-10-12-29-13-11-25/h2-6,8,14H,7,9-13,15H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | OFSBCZLLRPJVEK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |