C21H26FN3O5S — CID 55669624
5-(dimethylsulfamoyl)-N-[(3-fluoro-4-methoxyphenyl)methyl]-2-morpholin-4-ylbenzamide (PubChem CID 55669624) has the molecular formula C21H26FN3O5S and a molecular weight of 451.52 g/mol. Its IUPAC name is 5-(dimethylsulfamoyl)-N-[(3-fluoro-4-methoxyphenyl)methyl]-2-morpholin-4-ylbenzamide.
| Compound Name | 5-(dimethylsulfamoyl)-N-[(3-fluoro-4-methoxyphenyl)methyl]-2-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 55669624 |
| Molecular Formula | C21H26FN3O5S |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 5-(dimethylsulfamoyl)-N-[(3-fluoro-4-methoxyphenyl)methyl]-2-morpholin-4-ylbenzamide |
| SMILES | COc1ccc(CNC(=O)c2cc(S(=O)(=O)N(C)C)ccc2N2CCOCC2)cc1F |
| InChI | InChI=1S/C21H26FN3O5S/c1-24(2)31(27,28)16-5-6-19(25-8-10-30-11-9-25)17(13-16)21(26)23-14-15-4-7-20(29-3)18(22)12-15/h4-7,12-13H,8-11,14H2,1-3H3,(H,23,26) |
| InChIKey | DVCDWTYEZKHNOO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |