C20H23FN4O5S — CID 55333895
3-[[(4-fluorobenzoyl)amino]carbamoyl]-N,N-dimethyl-4-morpholin-4-ylbenzenesulfonamide (PubChem CID 55333895) has the molecular formula C20H23FN4O5S and a molecular weight of 450.49 g/mol. Its IUPAC name is 3-[[(4-fluorobenzoyl)amino]carbamoyl]-N,N-dimethyl-4-morpholin-4-ylbenzenesulfonamide.
| Compound Name | 3-[[(4-fluorobenzoyl)amino]carbamoyl]-N,N-dimethyl-4-morpholin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 55333895 |
| Molecular Formula | C20H23FN4O5S |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 3-[[(4-fluorobenzoyl)amino]carbamoyl]-N,N-dimethyl-4-morpholin-4-ylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(N2CCOCC2)c(C(=O)NNC(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C20H23FN4O5S/c1-24(2)31(28,29)16-7-8-18(25-9-11-30-12-10-25)17(13-16)20(27)23-22-19(26)14-3-5-15(21)6-4-14/h3-8,13H,9-12H2,1-2H3,(H,22,26)(H,23,27) |
| InChIKey | CTJBKARMJFLXBF-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|