C24H29N5O4S — CID 16625939
5-(dimethylsulfamoyl)-2-morpholin-4-yl-N-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]benzamide (PubChem CID 16625939) has the molecular formula C24H29N5O4S and a molecular weight of 483.59 g/mol. Its IUPAC name is 5-(dimethylsulfamoyl)-2-morpholin-4-yl-N-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]benzamide.
| Compound Name | 5-(dimethylsulfamoyl)-2-morpholin-4-yl-N-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 16625939 |
| Molecular Formula | C24H29N5O4S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 5-(dimethylsulfamoyl)-2-morpholin-4-yl-N-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]benzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(N2CCOCC2)c(C(=O)NCc2ccccc2Cn2cccn2)c1 |
| InChI | InChI=1S/C24H29N5O4S/c1-27(2)34(31,32)21-8-9-23(28-12-14-33-15-13-28)22(16-21)24(30)25-17-19-6-3-4-7-20(19)18-29-11-5-10-26-29/h3-11,16H,12-15,17-18H2,1-2H3,(H,25,30) |
| InChIKey | ZDUKQQAQMSFPSU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |