C19H21ClN2O6S — CID 46815086
2-(2-chlorophenoxy)ethyl 2-morpholin-4-yl-5-sulfamoylbenzoate (PubChem CID 46815086) has the molecular formula C19H21ClN2O6S and a molecular weight of 440.91 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)ethyl 2-morpholin-4-yl-5-sulfamoylbenzoate.
| Compound Name | 2-(2-chlorophenoxy)ethyl 2-morpholin-4-yl-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 46815086 |
| Molecular Formula | C19H21ClN2O6S |
| Molecular Weight | 440.91 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 2-(2-chlorophenoxy)ethyl 2-morpholin-4-yl-5-sulfamoylbenzoate |
| SMILES | NS(=O)(=O)c1ccc(N2CCOCC2)c(C(=O)OCCOc2ccccc2Cl)c1 |
| InChI | InChI=1S/C19H21ClN2O6S/c20-16-3-1-2-4-18(16)27-11-12-28-19(23)15-13-14(29(21,24)25)5-6-17(15)22-7-9-26-10-8-22/h1-6,13H,7-12H2,(H2,21,24,25) |
| InChIKey | JYBHHIILULUKJO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.91 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|