C23H28N2O5S — CID 24687259
benzyl 2-morpholin-4-yl-5-piperidin-1-ylsulfonylbenzoate (PubChem CID 24687259) has the molecular formula C23H28N2O5S and a molecular weight of 444.55 g/mol. Its IUPAC name is benzyl 2-morpholin-4-yl-5-piperidin-1-ylsulfonylbenzoate.
| Compound Name | benzyl 2-morpholin-4-yl-5-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 24687259 |
| Molecular Formula | C23H28N2O5S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | benzyl 2-morpholin-4-yl-5-piperidin-1-ylsulfonylbenzoate |
| SMILES | O=C(OCc1ccccc1)c1cc(S(=O)(=O)N2CCCCC2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C23H28N2O5S/c26-23(30-18-19-7-3-1-4-8-19)21-17-20(31(27,28)25-11-5-2-6-12-25)9-10-22(21)24-13-15-29-16-14-24/h1,3-4,7-10,17H,2,5-6,11-16,18H2 |
| InChIKey | XOECKCUQWRDYCP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |