C18H23N3O5S — CID 29201099
cyanomethyl 5-morpholin-4-ylsulfonyl-2-piperidin-1-ylbenzoate (PubChem CID 29201099) has the molecular formula C18H23N3O5S and a molecular weight of 393.47 g/mol. Its IUPAC name is cyanomethyl 5-morpholin-4-ylsulfonyl-2-piperidin-1-ylbenzoate.
| Compound Name | cyanomethyl 5-morpholin-4-ylsulfonyl-2-piperidin-1-ylbenzoate |
|---|---|
| PubChem CID | 29201099 |
| Molecular Formula | C18H23N3O5S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | cyanomethyl 5-morpholin-4-ylsulfonyl-2-piperidin-1-ylbenzoate |
| SMILES | N#CCOC(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1N1CCCCC1 |
| InChI | InChI=1S/C18H23N3O5S/c19-6-11-26-18(22)16-14-15(27(23,24)21-9-12-25-13-10-21)4-5-17(16)20-7-2-1-3-8-20/h4-5,14H,1-3,7-13H2 |
| InChIKey | VYIPRWMMVRWGIM-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 99.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |