C21H24N2O5S — CID 8765391
phenyl 5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylbenzoate (PubChem CID 8765391) has the molecular formula C21H24N2O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is phenyl 5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylbenzoate.
| Compound Name | phenyl 5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylbenzoate |
|---|---|
| PubChem CID | 8765391 |
| Molecular Formula | C21H24N2O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | phenyl 5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylbenzoate |
| SMILES | O=C(Oc1ccccc1)c1cc(S(=O)(=O)N2CCOCC2)ccc1N1CCCC1 |
| InChI | InChI=1S/C21H24N2O5S/c24-21(28-17-6-2-1-3-7-17)19-16-18(8-9-20(19)22-10-4-5-11-22)29(25,26)23-12-14-27-15-13-23/h1-3,6-9,16H,4-5,10-15H2 |
| InChIKey | BQLAOBITFAFFKX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|