C22H27N3O6S — CID 55360382
2-morpholin-4-yl-5-morpholin-4-ylsulfonyl-N-phenylmethoxybenzamide (PubChem CID 55360382) has the molecular formula C22H27N3O6S and a molecular weight of 461.54 g/mol. Its IUPAC name is 2-morpholin-4-yl-5-morpholin-4-ylsulfonyl-N-phenylmethoxybenzamide.
| Compound Name | 2-morpholin-4-yl-5-morpholin-4-ylsulfonyl-N-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 55360382 |
| Molecular Formula | C22H27N3O6S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 2-morpholin-4-yl-5-morpholin-4-ylsulfonyl-N-phenylmethoxybenzamide |
| SMILES | O=C(NOCc1ccccc1)c1cc(S(=O)(=O)N2CCOCC2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C22H27N3O6S/c26-22(23-31-17-18-4-2-1-3-5-18)20-16-19(32(27,28)25-10-14-30-15-11-25)6-7-21(20)24-8-12-29-13-9-24/h1-7,16H,8-15,17H2,(H,23,26) |
| InChIKey | UZXLGRWSCCFORI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|