C16H21N2O5S- — CID 2433198
2-morpholin-4-yl-5-piperidin-1-ylsulfonylbenzoate (PubChem CID 2433198) has the molecular formula C16H21N2O5S- and a molecular weight of 353.42 g/mol. Its IUPAC name is 2-morpholin-4-yl-5-piperidin-1-ylsulfonylbenzoate.
| Compound Name | 2-morpholin-4-yl-5-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2433198 |
| Molecular Formula | C16H21N2O5S- |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 2-morpholin-4-yl-5-piperidin-1-ylsulfonylbenzoate |
| SMILES | O=C([O-])c1cc(S(=O)(=O)N2CCCCC2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C16H22N2O5S/c19-16(20)14-12-13(24(21,22)18-6-2-1-3-7-18)4-5-15(14)17-8-10-23-11-9-17/h4-5,12H,1-3,6-11H2,(H,19,20)/p-1 |
| InChIKey | JJVKRATVEXYRKZ-UHFFFAOYSA-M |
| XLogP | 0.06 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |