C25H32N2O5S — CID 16543802
(2,5-dimethylphenyl)methyl 2-morpholin-4-yl-5-piperidin-1-ylsulfonylbenzoate (PubChem CID 16543802) has the molecular formula C25H32N2O5S and a molecular weight of 472.61 g/mol. Its IUPAC name is (2,5-dimethylphenyl)methyl 2-morpholin-4-yl-5-piperidin-1-ylsulfonylbenzoate.
| Compound Name | (2,5-dimethylphenyl)methyl 2-morpholin-4-yl-5-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 16543802 |
| Molecular Formula | C25H32N2O5S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | (2,5-dimethylphenyl)methyl 2-morpholin-4-yl-5-piperidin-1-ylsulfonylbenzoate |
| SMILES | Cc1ccc(C)c(COC(=O)c2cc(S(=O)(=O)N3CCCCC3)ccc2N2CCOCC2)c1 |
| InChI | InChI=1S/C25H32N2O5S/c1-19-6-7-20(2)21(16-19)18-32-25(28)23-17-22(33(29,30)27-10-4-3-5-11-27)8-9-24(23)26-12-14-31-15-13-26/h6-9,16-17H,3-5,10-15,18H2,1-2H3 |
| InChIKey | VZGJODFPIWGNFE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |