C20H30N2O6S — CID 55355273
2-ethoxyethyl 2-morpholin-4-yl-5-piperidin-1-ylsulfonylbenzoate (PubChem CID 55355273) has the molecular formula C20H30N2O6S and a molecular weight of 426.54 g/mol. Its IUPAC name is 2-ethoxyethyl 2-morpholin-4-yl-5-piperidin-1-ylsulfonylbenzoate.
| Compound Name | 2-ethoxyethyl 2-morpholin-4-yl-5-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 55355273 |
| Molecular Formula | C20H30N2O6S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 2-ethoxyethyl 2-morpholin-4-yl-5-piperidin-1-ylsulfonylbenzoate |
| SMILES | CCOCCOC(=O)c1cc(S(=O)(=O)N2CCCCC2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C20H30N2O6S/c1-2-26-14-15-28-20(23)18-16-17(29(24,25)22-8-4-3-5-9-22)6-7-19(18)21-10-12-27-13-11-21/h6-7,16H,2-5,8-15H2,1H3 |
| InChIKey | FIGCCHHDLTYEJH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|