C24H31N3O5S — CID 55331545
3-pyridin-3-ylpropyl 5-morpholin-4-ylsulfonyl-2-piperidin-1-ylbenzoate (PubChem CID 55331545) has the molecular formula C24H31N3O5S and a molecular weight of 473.60 g/mol. Its IUPAC name is 3-pyridin-3-ylpropyl 5-morpholin-4-ylsulfonyl-2-piperidin-1-ylbenzoate.
| Compound Name | 3-pyridin-3-ylpropyl 5-morpholin-4-ylsulfonyl-2-piperidin-1-ylbenzoate |
|---|---|
| PubChem CID | 55331545 |
| Molecular Formula | C24H31N3O5S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 3-pyridin-3-ylpropyl 5-morpholin-4-ylsulfonyl-2-piperidin-1-ylbenzoate |
| SMILES | O=C(OCCCc1cccnc1)c1cc(S(=O)(=O)N2CCOCC2)ccc1N1CCCCC1 |
| InChI | InChI=1S/C24H31N3O5S/c28-24(32-15-5-7-20-6-4-10-25-19-20)22-18-21(33(29,30)27-13-16-31-17-14-27)8-9-23(22)26-11-2-1-3-12-26/h4,6,8-10,18-19H,1-3,5,7,11-17H2 |
| InChIKey | BXJLEVAFEPOROY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|