C19H21N3O5 — CID 55331489
3-pyridin-3-ylpropyl 2-morpholin-4-yl-5-nitrobenzoate (PubChem CID 55331489) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is 3-pyridin-3-ylpropyl 2-morpholin-4-yl-5-nitrobenzoate.
| Compound Name | 3-pyridin-3-ylpropyl 2-morpholin-4-yl-5-nitrobenzoate |
|---|---|
| PubChem CID | 55331489 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 3-pyridin-3-ylpropyl 2-morpholin-4-yl-5-nitrobenzoate |
| SMILES | O=C(OCCCc1cccnc1)c1cc([N+](=O)[O-])ccc1N1CCOCC1 |
| InChI | InChI=1S/C19H21N3O5/c23-19(27-10-2-4-15-3-1-7-20-14-15)17-13-16(22(24)25)5-6-18(17)21-8-11-26-12-9-21/h1,3,5-7,13-14H,2,4,8-12H2 |
| InChIKey | FBYJTSOGJCOIII-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|