About 2-(2-fluorophenoxy)ethyl 2-morpholin-4-yl-5-nitrobenzoate
2-(2-fluorophenoxy)ethyl 2-morpholin-4-yl-5-nitrobenzoate (PubChem CID 9118295) has the molecular formula C19H19FN2O6
and a molecular weight of 390.37 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)ethyl 2-morpholin-4-yl-5-nitrobenzoate.
Molecular Properties
| Compound Name | 2-(2-fluorophenoxy)ethyl 2-morpholin-4-yl-5-nitrobenzoate |
| PubChem CID | 9118295 |
| Molecular Formula | C19H19FN2O6 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 2-(2-fluorophenoxy)ethyl 2-morpholin-4-yl-5-nitrobenzoate |
| SMILES | O=C(OCCOc1ccccc1F)c1cc([N+](=O)[O-])ccc1N1CCOCC1 |
| InChI | InChI=1S/C19H19FN2O6/c20-16-3-1-2-4-18(16)27-11-12-28-19(23)15-13-14(22(24)25)5-6-17(15)21-7-9-26-10-8-21/h1-6,13H,7-12H2 |
| InChIKey | CVZSUFXRWACQBF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-fluorophenoxy)ethyl 2-morpholin-4-yl-5-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluorophenoxy)ethyl 2-morpholin-4-yl-5-nitrobenzoate?
The IUPAC name of 2-(2-fluorophenoxy)ethyl 2-morpholin-4-yl-5-nitrobenzoate (CID 9118295) is 2-(2-fluorophenoxy)ethyl 2-morpholin-4-yl-5-nitrobenzoate.
What is the SMILES notation for 2-(2-fluorophenoxy)ethyl 2-morpholin-4-yl-5-nitrobenzoate?
The canonical SMILES for 2-(2-fluorophenoxy)ethyl 2-morpholin-4-yl-5-nitrobenzoate is O=C(OCCOc1ccccc1F)c1cc([N+](=O)[O-])ccc1N1CCOCC1.
What is the InChIKey of 2-(2-fluorophenoxy)ethyl 2-morpholin-4-yl-5-nitrobenzoate?
The InChIKey is CVZSUFXRWACQBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19FN2O6/c20-16-3-1-2-4-18(16)27-11-12-28-19(23)15-13-14(22(24)25)5-6-17(15)21-7-9-26-10-8-21/h1-6,13H,7-12H2.
What are the key properties of 2-(2-fluorophenoxy)ethyl 2-morpholin-4-yl-5-nitrobenzoate?
2-(2-fluorophenoxy)ethyl 2-morpholin-4-yl-5-nitrobenzoate has a molecular weight of 390.37 g/mol, XLogP of 2.81, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluorophenoxy)ethyl 2-morpholin-4-yl-5-nitrobenzoate is sourced from PubChem (CID 9118295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).