C23H29N3O4S2 — CID 42369200
N-(4-methylsulfanylphenyl)-2-morpholin-4-yl-5-piperidin-1-ylsulfonylbenzamide (PubChem CID 42369200) has the molecular formula C23H29N3O4S2 and a molecular weight of 475.64 g/mol. Its IUPAC name is N-(4-methylsulfanylphenyl)-2-morpholin-4-yl-5-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(4-methylsulfanylphenyl)-2-morpholin-4-yl-5-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 42369200 |
| Molecular Formula | C23H29N3O4S2 |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | N-(4-methylsulfanylphenyl)-2-morpholin-4-yl-5-piperidin-1-ylsulfonylbenzamide |
| SMILES | CSc1ccc(NC(=O)c2cc(S(=O)(=O)N3CCCCC3)ccc2N2CCOCC2)cc1 |
| InChI | InChI=1S/C23H29N3O4S2/c1-31-19-7-5-18(6-8-19)24-23(27)21-17-20(32(28,29)26-11-3-2-4-12-26)9-10-22(21)25-13-15-30-16-14-25/h5-10,17H,2-4,11-16H2,1H3,(H,24,27) |
| InChIKey | CSFVXMINVAQLGR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |