C19H21Cl2N3O4S — CID 55971836
N-[2-(2,3-dichlorophenyl)ethyl]-2-morpholin-4-yl-5-sulfamoylbenzamide (PubChem CID 55971836) has the molecular formula C19H21Cl2N3O4S and a molecular weight of 458.37 g/mol. Its IUPAC name is N-[2-(2,3-dichlorophenyl)ethyl]-2-morpholin-4-yl-5-sulfamoylbenzamide.
| Compound Name | N-[2-(2,3-dichlorophenyl)ethyl]-2-morpholin-4-yl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 55971836 |
| Molecular Formula | C19H21Cl2N3O4S |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | N-[2-(2,3-dichlorophenyl)ethyl]-2-morpholin-4-yl-5-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1ccc(N2CCOCC2)c(C(=O)NCCc2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C19H21Cl2N3O4S/c20-16-3-1-2-13(18(16)21)6-7-23-19(25)15-12-14(29(22,26)27)4-5-17(15)24-8-10-28-11-9-24/h1-5,12H,6-11H2,(H,23,25)(H2,22,26,27) |
| InChIKey | LAWAQFRANOIXMZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |