C16H26Cl2N4O4S — CID 119428703
2-morpholin-4-yl-N-piperidin-3-yl-5-sulfamoylbenzamide;dihydrochloride (PubChem CID 119428703) has the molecular formula C16H26Cl2N4O4S and a molecular weight of 441.38 g/mol. Its IUPAC name is 2-morpholin-4-yl-N-piperidin-3-yl-5-sulfamoylbenzamide;dihydrochloride.
| Compound Name | 2-morpholin-4-yl-N-piperidin-3-yl-5-sulfamoylbenzamide;dihydrochloride |
|---|---|
| PubChem CID | 119428703 |
| Molecular Formula | C16H26Cl2N4O4S |
| Molecular Weight | 441.38 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 2-morpholin-4-yl-N-piperidin-3-yl-5-sulfamoylbenzamide;dihydrochloride |
| SMILES | Cl.Cl.NS(=O)(=O)c1ccc(N2CCOCC2)c(C(=O)NC2CCCNC2)c1 |
| InChI | InChI=1S/C16H24N4O4S.2ClH/c17-25(22,23)13-3-4-15(20-6-8-24-9-7-20)14(10-13)16(21)19-12-2-1-5-18-11-12;;/h3-4,10,12,18H,1-2,5-9,11H2,(H,19,21)(H2,17,22,23);2*1H |
| InChIKey | YHXYCXWQIGBVMY-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.38 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |