C17H17F2N3O4S — CID 41452357
N-(3,4-difluorophenyl)-2-morpholin-4-yl-5-sulfamoylbenzamide (PubChem CID 41452357) has the molecular formula C17H17F2N3O4S and a molecular weight of 397.40 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-morpholin-4-yl-5-sulfamoylbenzamide.
| Compound Name | N-(3,4-difluorophenyl)-2-morpholin-4-yl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 41452357 |
| Molecular Formula | C17H17F2N3O4S |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-morpholin-4-yl-5-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1ccc(N2CCOCC2)c(C(=O)Nc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C17H17F2N3O4S/c18-14-3-1-11(9-15(14)19)21-17(23)13-10-12(27(20,24)25)2-4-16(13)22-5-7-26-8-6-22/h1-4,9-10H,5-8H2,(H,21,23)(H2,20,24,25) |
| InChIKey | QZJCIURZFYDDLC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |