C18H19N5O6S2 — CID 23096049
2-morpholin-4-yl-5-nitro-N-[(4-sulfamoylphenyl)carbamothioyl]benzamide (PubChem CID 23096049) has the molecular formula C18H19N5O6S2 and a molecular weight of 465.51 g/mol. Its IUPAC name is 2-morpholin-4-yl-5-nitro-N-[(4-sulfamoylphenyl)carbamothioyl]benzamide.
| Compound Name | 2-morpholin-4-yl-5-nitro-N-[(4-sulfamoylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 23096049 |
| Molecular Formula | C18H19N5O6S2 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | 2-morpholin-4-yl-5-nitro-N-[(4-sulfamoylphenyl)carbamothioyl]benzamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=S)NC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H19N5O6S2/c19-31(27,28)14-4-1-12(2-5-14)20-18(30)21-17(24)15-11-13(23(25)26)3-6-16(15)22-7-9-29-10-8-22/h1-6,11H,7-10H2,(H2,19,27,28)(H2,20,21,24,30) |
| InChIKey | ZIQHFMXOOMCZPZ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 156.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|