C20H20N4O5S — CID 28688268
4-[(5-nitro-2-piperidin-1-ylbenzoyl)carbamothioylamino]benzoic acid (PubChem CID 28688268) has the molecular formula C20H20N4O5S and a molecular weight of 428.47 g/mol. Its IUPAC name is 4-[(5-nitro-2-piperidin-1-ylbenzoyl)carbamothioylamino]benzoic acid.
| Compound Name | 4-[(5-nitro-2-piperidin-1-ylbenzoyl)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 28688268 |
| Molecular Formula | C20H20N4O5S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 4-[(5-nitro-2-piperidin-1-ylbenzoyl)carbamothioylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=S)NC(=O)c2cc([N+](=O)[O-])ccc2N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H20N4O5S/c25-18(22-20(30)21-14-6-4-13(5-7-14)19(26)27)16-12-15(24(28)29)8-9-17(16)23-10-2-1-3-11-23/h4-9,12H,1-3,10-11H2,(H,26,27)(H2,21,22,25,30) |
| InChIKey | LNGBPFIBZRFXSX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 124.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|