C20H20ClN3O5 — CID 34267022
methyl 2-chloro-5-[(5-nitro-2-piperidin-1-ylbenzoyl)amino]benzoate (PubChem CID 34267022) has the molecular formula C20H20ClN3O5 and a molecular weight of 417.85 g/mol. Its IUPAC name is methyl 2-chloro-5-[(5-nitro-2-piperidin-1-ylbenzoyl)amino]benzoate.
| Compound Name | methyl 2-chloro-5-[(5-nitro-2-piperidin-1-ylbenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 34267022 |
| Molecular Formula | C20H20ClN3O5 |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | methyl 2-chloro-5-[(5-nitro-2-piperidin-1-ylbenzoyl)amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)c2cc([N+](=O)[O-])ccc2N2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C20H20ClN3O5/c1-29-20(26)15-11-13(5-7-17(15)21)22-19(25)16-12-14(24(27)28)6-8-18(16)23-9-3-2-4-10-23/h5-8,11-12H,2-4,9-10H2,1H3,(H,22,25) |
| InChIKey | ZWGQXEDAJZIZJG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|