C21H23ClN4O5S — CID 55329333
N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)-5-nitro-2-pyrrolidin-1-ylbenzamide (PubChem CID 55329333) has the molecular formula C21H23ClN4O5S and a molecular weight of 478.96 g/mol. Its IUPAC name is N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)-5-nitro-2-pyrrolidin-1-ylbenzamide.
| Compound Name | N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)-5-nitro-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 55329333 |
| Molecular Formula | C21H23ClN4O5S |
| Molecular Weight | 478.96 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)-5-nitro-2-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(Nc1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1)c1cc([N+](=O)[O-])ccc1N1CCCC1 |
| InChI | InChI=1S/C21H23ClN4O5S/c22-18-7-5-15(13-20(18)32(30,31)25-11-3-4-12-25)23-21(27)17-14-16(26(28)29)6-8-19(17)24-9-1-2-10-24/h5-8,13-14H,1-4,9-12H2,(H,23,27) |
| InChIKey | VCJHPVUNQNCVKG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.96 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|