C21H19N3O3 — CID 9068527
N-naphthalen-2-yl-5-nitro-2-pyrrolidin-1-ylbenzamide (PubChem CID 9068527) has the molecular formula C21H19N3O3 and a molecular weight of 361.40 g/mol. Its IUPAC name is N-naphthalen-2-yl-5-nitro-2-pyrrolidin-1-ylbenzamide.
| Compound Name | N-naphthalen-2-yl-5-nitro-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 9068527 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | N-naphthalen-2-yl-5-nitro-2-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(Nc1ccc2ccccc2c1)c1cc([N+](=O)[O-])ccc1N1CCCC1 |
| InChI | InChI=1S/C21H19N3O3/c25-21(22-17-8-7-15-5-1-2-6-16(15)13-17)19-14-18(24(26)27)9-10-20(19)23-11-3-4-12-23/h1-2,5-10,13-14H,3-4,11-12H2,(H,22,25) |
| InChIKey | WMQBKFJHHFXTCA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|