C21H25ClN4O6S — CID 16963286
N-(4-chloro-3-piperidin-1-ylsulfonylphenyl)-2-(2-methoxyethylamino)-5-nitrobenzamide (PubChem CID 16963286) has the molecular formula C21H25ClN4O6S and a molecular weight of 496.97 g/mol. Its IUPAC name is N-(4-chloro-3-piperidin-1-ylsulfonylphenyl)-2-(2-methoxyethylamino)-5-nitrobenzamide.
| Compound Name | N-(4-chloro-3-piperidin-1-ylsulfonylphenyl)-2-(2-methoxyethylamino)-5-nitrobenzamide |
|---|---|
| PubChem CID | 16963286 |
| Molecular Formula | C21H25ClN4O6S |
| Molecular Weight | 496.97 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | N-(4-chloro-3-piperidin-1-ylsulfonylphenyl)-2-(2-methoxyethylamino)-5-nitrobenzamide |
| SMILES | COCCNc1ccc([N+](=O)[O-])cc1C(=O)Nc1ccc(Cl)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C21H25ClN4O6S/c1-32-12-9-23-19-8-6-16(26(28)29)14-17(19)21(27)24-15-5-7-18(22)20(13-15)33(30,31)25-10-3-2-4-11-25/h5-8,13-14,23H,2-4,9-12H2,1H3,(H,24,27) |
| InChIKey | GTDGWUDLGZFTAT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.97 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|